C20H24N4O4 — CID 46959170
10-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one (PubChem CID 46959170) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 10-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one.
| Compound Name | 10-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
|---|---|
| PubChem CID | 46959170 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 10-[2-[3-(hydroxymethyl)piperidin-1-yl]-2-oxoethyl]-4-methyl-7-prop-2-enyl-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-9-one |
| SMILES | C=CCn1c2cc(C)oc2c2cnn(CC(=O)N3CCCC(CO)C3)c(=O)c21 |
| InChI | InChI=1S/C20H24N4O4/c1-3-6-23-16-8-13(2)28-19(16)15-9-21-24(20(27)18(15)23)11-17(26)22-7-4-5-14(10-22)12-25/h3,8-9,14,25H,1,4-7,10-12H2,2H3 |
| InChIKey | INNMJTUNWKJXEA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|