C24H31NO4 — CID 46966235
1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol (PubChem CID 46966235) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol.
| Compound Name | 1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 46966235 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol |
| SMILES | C=CCc1cc(CN2CCC(O)(c3ccccc3OC)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C24H31NO4/c1-5-8-19-15-18(16-22(28-3)23(19)29-4)17-25-13-11-24(26,12-14-25)20-9-6-7-10-21(20)27-2/h5-7,9-10,15-16,26H,1,8,11-14,17H2,2-4H3 |
| InChIKey | CPIWGUFOLOWHEC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|