C20H27N3O4S — CID 46967029
methyl 4-[2-[1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethyl]benzoate (PubChem CID 46967029) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is methyl 4-[2-[1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 46967029 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | methyl 4-[2-[1-(1-ethylpyrazol-4-yl)sulfonylpiperidin-4-yl]ethyl]benzoate |
| SMILES | CCn1cc(S(=O)(=O)N2CCC(CCc3ccc(C(=O)OC)cc3)CC2)cn1 |
| InChI | InChI=1S/C20H27N3O4S/c1-3-22-15-19(14-21-22)28(25,26)23-12-10-17(11-13-23)5-4-16-6-8-18(9-7-16)20(24)27-2/h6-9,14-15,17H,3-5,10-13H2,1-2H3 |
| InChIKey | QXUSCAVFEFTZNM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |