C23H32N4O3 — CID 46968942
2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(piperidin-1-ylmethyl)phenyl]acetamide (PubChem CID 46968942) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(piperidin-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(piperidin-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 46968942 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-(piperidin-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(CC1NC(=O)N(C2CCCCC2)C1=O)Nc1ccccc1CN1CCCCC1 |
| InChI | InChI=1S/C23H32N4O3/c28-21(15-20-22(29)27(23(30)25-20)18-10-3-1-4-11-18)24-19-12-6-5-9-17(19)16-26-13-7-2-8-14-26/h5-6,9,12,18,20H,1-4,7-8,10-11,13-16H2,(H,24,28)(H,25,30) |
| InChIKey | RQGCNWJNZUOCTJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|