C18H24FN3O2 — CID 46970496
2-[1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(1-methylcyclobutyl)acetamide (PubChem CID 46970496) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 2-[1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(1-methylcyclobutyl)acetamide.
| Compound Name | 2-[1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(1-methylcyclobutyl)acetamide |
|---|---|
| PubChem CID | 46970496 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-[1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]-N-(1-methylcyclobutyl)acetamide |
| SMILES | CC1(NC(=O)CC2C(=O)NCCN2Cc2cccc(F)c2)CCC1 |
| InChI | InChI=1S/C18H24FN3O2/c1-18(6-3-7-18)21-16(23)11-15-17(24)20-8-9-22(15)12-13-4-2-5-14(19)10-13/h2,4-5,10,15H,3,6-9,11-12H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | BNBGPYXVHVQMQE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |