C16H21FN4O3 — CID 95716172
3-[[2-[(2R)-1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]amino]propanamide (PubChem CID 95716172) has the molecular formula C16H21FN4O3 and a molecular weight of 336.37 g/mol. Its IUPAC name is 3-[[2-[(2R)-1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]amino]propanamide.
| Compound Name | 3-[[2-[(2R)-1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]amino]propanamide |
|---|---|
| PubChem CID | 95716172 |
| Molecular Formula | C16H21FN4O3 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-[[2-[(2R)-1-[(3-fluorophenyl)methyl]-3-oxopiperazin-2-yl]acetyl]amino]propanamide |
| SMILES | NC(=O)CCNC(=O)C[C@@H]1C(=O)NCCN1Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN4O3/c17-12-3-1-2-11(8-12)10-21-7-6-20-16(24)13(21)9-15(23)19-5-4-14(18)22/h1-3,8,13H,4-7,9-10H2,(H2,18,22)(H,19,23)(H,20,24)/t13-/m1/s1 |
| InChIKey | YKRRIXGAIRBKHJ-CYBMUJFWSA-N |
| XLogP | -0.49 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |