C18H21F2N3O2 — CID 46971391
1-(difluoromethyl)-N-[[4-(4-methylphenyl)oxan-4-yl]methyl]pyrazole-3-carboxamide (PubChem CID 46971391) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[[4-(4-methylphenyl)oxan-4-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | 1-(difluoromethyl)-N-[[4-(4-methylphenyl)oxan-4-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 46971391 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-(difluoromethyl)-N-[[4-(4-methylphenyl)oxan-4-yl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(C2(CNC(=O)c3ccn(C(F)F)n3)CCOCC2)cc1 |
| InChI | InChI=1S/C18H21F2N3O2/c1-13-2-4-14(5-3-13)18(7-10-25-11-8-18)12-21-16(24)15-6-9-23(22-15)17(19)20/h2-6,9,17H,7-8,10-12H2,1H3,(H,21,24) |
| InChIKey | HCYQNGUAHXUEGL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |