C18H24N4O3S — CID 46971443
1-acetyl-N-[3-(2-methylimidazol-1-yl)propyl]-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 46971443) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-acetyl-N-[3-(2-methylimidazol-1-yl)propyl]-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-acetyl-N-[3-(2-methylimidazol-1-yl)propyl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 46971443 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-acetyl-N-[3-(2-methylimidazol-1-yl)propyl]-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | CC(=O)N1CCCc2cc(S(=O)(=O)NCCCn3ccnc3C)ccc21 |
| InChI | InChI=1S/C18H24N4O3S/c1-14-19-9-12-21(14)10-4-8-20-26(24,25)17-6-7-18-16(13-17)5-3-11-22(18)15(2)23/h6-7,9,12-13,20H,3-5,8,10-11H2,1-2H3 |
| InChIKey | XBTDAFPUEYNDPF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|