C19H29N5O2S — CID 46972569
3,3-dimethyl-4-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one (PubChem CID 46972569) has the molecular formula C19H29N5O2S and a molecular weight of 391.54 g/mol. Its IUPAC name is 3,3-dimethyl-4-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one.
| Compound Name | 3,3-dimethyl-4-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 46972569 |
| Molecular Formula | C19H29N5O2S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3,3-dimethyl-4-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acetyl]-4a,5,6,7,8,8a-hexahydro-1H-quinoxalin-2-one |
| SMILES | CC1(C)C(=O)NC2CCCCC2N1C(=O)CN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H29N5O2S/c1-19(2)17(26)21-14-5-3-4-6-15(14)24(19)16(25)13-22-8-10-23(11-9-22)18-20-7-12-27-18/h7,12,14-15H,3-6,8-11,13H2,1-2H3,(H,21,26) |
| InChIKey | DGHGIZBGMOIECQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |