About N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide
N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide (PubChem CID 46975532) has the molecular formula C23H20N6O2
and a molecular weight of 412.45 g/mol. Its IUPAC name is N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 46975532 |
| Molecular Formula | C23H20N6O2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCn1cc(-c2cc(C(=O)Nc3ccc4nc(Cc5ccccc5)[nH]c4c3)no2)cn1 |
| InChI | InChI=1S/C23H20N6O2/c1-2-29-14-16(13-24-29)21-12-20(28-31-21)23(30)25-17-8-9-18-19(11-17)27-22(26-18)10-15-6-4-3-5-7-15/h3-9,11-14H,2,10H2,1H3,(H,25,30)(H,26,27) |
| InChIKey | RJZIMIZWYUHPIS-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide (CID 46975532) is N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide is CCn1cc(-c2cc(C(=O)Nc3ccc4nc(Cc5ccccc5)[nH]c4c3)no2)cn1.
What is the InChIKey of N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is RJZIMIZWYUHPIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N6O2/c1-2-29-14-16(13-24-29)21-12-20(28-31-21)23(30)25-17-8-9-18-19(11-17)27-22(26-18)10-15-6-4-3-5-7-15/h3-9,11-14H,2,10H2,1H3,(H,25,30)(H,26,27).
What are the key properties of N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide?
N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 412.45 g/mol, XLogP of 4.28, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-benzyl-3H-benzimidazol-5-yl)-5-(1-ethylpyrazol-4-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 46975532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).