C19H20N4O5 — CID 46975893
8-[3-(3-methoxyphenyl)-1,2-oxazole-5-carbonyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 46975893) has the molecular formula C19H20N4O5 and a molecular weight of 384.39 g/mol. Its IUPAC name is 8-[3-(3-methoxyphenyl)-1,2-oxazole-5-carbonyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[3-(3-methoxyphenyl)-1,2-oxazole-5-carbonyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 46975893 |
| Molecular Formula | C19H20N4O5 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 8-[3-(3-methoxyphenyl)-1,2-oxazole-5-carbonyl]-3-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCC4(CC3)NC(=O)N(C)C4=O)on2)c1 |
| InChI | InChI=1S/C19H20N4O5/c1-22-17(25)19(20-18(22)26)6-8-23(9-7-19)16(24)15-11-14(21-28-15)12-4-3-5-13(10-12)27-2/h3-5,10-11H,6-9H2,1-2H3,(H,20,26) |
| InChIKey | SNHZPBLOAXWUBZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|