C22H23N3O2 — CID 46976355
1-cyclopropyl-N-[cyclopropyl-(4-methoxyphenyl)methyl]benzimidazole-5-carboxamide (PubChem CID 46976355) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-cyclopropyl-N-[cyclopropyl-(4-methoxyphenyl)methyl]benzimidazole-5-carboxamide.
| Compound Name | 1-cyclopropyl-N-[cyclopropyl-(4-methoxyphenyl)methyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 46976355 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-cyclopropyl-N-[cyclopropyl-(4-methoxyphenyl)methyl]benzimidazole-5-carboxamide |
| SMILES | COc1ccc(C(NC(=O)c2ccc3c(c2)ncn3C2CC2)C2CC2)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-27-18-9-4-15(5-10-18)21(14-2-3-14)24-22(26)16-6-11-20-19(12-16)23-13-25(20)17-7-8-17/h4-6,9-14,17,21H,2-3,7-8H2,1H3,(H,24,26) |
| InChIKey | JRGFDRXVBUKPRJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |