C22H20ClN3O2 — CID 51688261
2-(4-chlorophenyl)-N-[(S)-cyclopropyl-(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide (PubChem CID 51688261) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(S)-cyclopropyl-(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(S)-cyclopropyl-(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 51688261 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(S)-cyclopropyl-(4-methoxyphenyl)methyl]pyrimidine-5-carboxamide |
| SMILES | COc1ccc([C@@H](NC(=O)c2cnc(-c3ccc(Cl)cc3)nc2)C2CC2)cc1 |
| InChI | InChI=1S/C22H20ClN3O2/c1-28-19-10-6-15(7-11-19)20(14-2-3-14)26-22(27)17-12-24-21(25-13-17)16-4-8-18(23)9-5-16/h4-14,20H,2-3H2,1H3,(H,26,27)/t20-/m0/s1 |
| InChIKey | GBSAEAPJFRMJDK-FQEVSTJZSA-N |
| XLogP | 4.69 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |