C19H19Cl2NO3 — CID 45353412
3-chloro-N-[(4-chlorophenyl)-cyclopropylmethyl]-4,5-dimethoxybenzamide (PubChem CID 45353412) has the molecular formula C19H19Cl2NO3 and a molecular weight of 380.27 g/mol. Its IUPAC name is 3-chloro-N-[(4-chlorophenyl)-cyclopropylmethyl]-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-[(4-chlorophenyl)-cyclopropylmethyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 45353412 |
| Molecular Formula | C19H19Cl2NO3 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3-chloro-N-[(4-chlorophenyl)-cyclopropylmethyl]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(c2ccc(Cl)cc2)C2CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H19Cl2NO3/c1-24-16-10-13(9-15(21)18(16)25-2)19(23)22-17(11-3-4-11)12-5-7-14(20)8-6-12/h5-11,17H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | RJYXRNONRGTZBR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |