C19H16N4O2 — CID 4697714
2-(benzotriazol-1-yl)-3-(propylamino)naphthalene-1,4-dione (PubChem CID 4697714) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-3-(propylamino)naphthalene-1,4-dione.
| Compound Name | 2-(benzotriazol-1-yl)-3-(propylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 4697714 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(benzotriazol-1-yl)-3-(propylamino)naphthalene-1,4-dione |
| SMILES | CCCNC1=C(n2nnc3ccccc32)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16N4O2/c1-2-11-20-16-17(23-15-10-6-5-9-14(15)21-22-23)19(25)13-8-4-3-7-12(13)18(16)24/h3-10,20H,2,11H2,1H3 |
| InChIKey | LVWBHFIUPFCVNS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|