C19H16N4O3 — CID 4697720
2-(benzotriazol-1-yl)-3-(3-hydroxypropylamino)naphthalene-1,4-dione (PubChem CID 4697720) has the molecular formula C19H16N4O3 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-3-(3-hydroxypropylamino)naphthalene-1,4-dione.
| Compound Name | 2-(benzotriazol-1-yl)-3-(3-hydroxypropylamino)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 4697720 |
| Molecular Formula | C19H16N4O3 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-(benzotriazol-1-yl)-3-(3-hydroxypropylamino)naphthalene-1,4-dione |
| SMILES | O=C1C(NCCCO)=C(n2nnc3ccccc32)C(=O)c2ccccc21 |
| InChI | InChI=1S/C19H16N4O3/c24-11-5-10-20-16-17(23-15-9-4-3-8-14(15)21-22-23)19(26)13-7-2-1-6-12(13)18(16)25/h1-4,6-9,20,24H,5,10-11H2 |
| InChIKey | VIJAECDSYNZTHJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|