C24H26F2N2O2 — CID 46978008
N-[1-(5-fluoro-1-methylindol-3-yl)propan-2-yl]-4-(3-fluorophenyl)oxane-4-carboxamide (PubChem CID 46978008) has the molecular formula C24H26F2N2O2 and a molecular weight of 412.48 g/mol. Its IUPAC name is N-[1-(5-fluoro-1-methylindol-3-yl)propan-2-yl]-4-(3-fluorophenyl)oxane-4-carboxamide.
| Compound Name | N-[1-(5-fluoro-1-methylindol-3-yl)propan-2-yl]-4-(3-fluorophenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 46978008 |
| Molecular Formula | C24H26F2N2O2 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[1-(5-fluoro-1-methylindol-3-yl)propan-2-yl]-4-(3-fluorophenyl)oxane-4-carboxamide |
| SMILES | CC(Cc1cn(C)c2ccc(F)cc12)NC(=O)C1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C24H26F2N2O2/c1-16(12-17-15-28(2)22-7-6-20(26)14-21(17)22)27-23(29)24(8-10-30-11-9-24)18-4-3-5-19(25)13-18/h3-7,13-16H,8-12H2,1-2H3,(H,27,29) |
| InChIKey | LPGDQPUVRGPOLY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |