C19H20FN3O — CID 46981781
2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl-(pyridin-3-ylmethyl)amino]ethanol (PubChem CID 46981781) has the molecular formula C19H20FN3O and a molecular weight of 325.39 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl-(pyridin-3-ylmethyl)amino]ethanol.
| Compound Name | 2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl-(pyridin-3-ylmethyl)amino]ethanol |
|---|---|
| PubChem CID | 46981781 |
| Molecular Formula | C19H20FN3O |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)pyrrol-2-yl]methyl-(pyridin-3-ylmethyl)amino]ethanol |
| SMILES | OCCN(Cc1cccnc1)Cc1cccn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FN3O/c20-17-5-7-18(8-6-17)23-10-2-4-19(23)15-22(11-12-24)14-16-3-1-9-21-13-16/h1-10,13,24H,11-12,14-15H2 |
| InChIKey | WAQMBLXZLPLFDJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |