C17H22FN3OS — CID 46983189
N-[(2-ethylsulfanylpyrimidin-5-yl)methyl]-N-[(2-fluorophenyl)methyl]-2-methoxyethanamine (PubChem CID 46983189) has the molecular formula C17H22FN3OS and a molecular weight of 335.45 g/mol. Its IUPAC name is N-[(2-ethylsulfanylpyrimidin-5-yl)methyl]-N-[(2-fluorophenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(2-ethylsulfanylpyrimidin-5-yl)methyl]-N-[(2-fluorophenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 46983189 |
| Molecular Formula | C17H22FN3OS |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | N-[(2-ethylsulfanylpyrimidin-5-yl)methyl]-N-[(2-fluorophenyl)methyl]-2-methoxyethanamine |
| SMILES | CCSc1ncc(CN(CCOC)Cc2ccccc2F)cn1 |
| InChI | InChI=1S/C17H22FN3OS/c1-3-23-17-19-10-14(11-20-17)12-21(8-9-22-2)13-15-6-4-5-7-16(15)18/h4-7,10-11H,3,8-9,12-13H2,1-2H3 |
| InChIKey | DYVRELMPCNFWBG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |