C17H23NO3S — CID 46983940
5-(methoxymethyl)-N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]furan-2-carboxamide (PubChem CID 46983940) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46983940 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 5-(methoxymethyl)-N-(2-methylpropyl)-N-[(3-methylthiophen-2-yl)methyl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)N(Cc2sccc2C)CC(C)C)o1 |
| InChI | InChI=1S/C17H23NO3S/c1-12(2)9-18(10-16-13(3)7-8-22-16)17(19)15-6-5-14(21-15)11-20-4/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | LIKUBJFJDZPIDX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |