C19H18FN5O — CID 46984125
(3-fluorophenyl)-[4-(4-pyridin-3-yltriazol-1-yl)piperidin-1-yl]methanone (PubChem CID 46984125) has the molecular formula C19H18FN5O and a molecular weight of 351.38 g/mol. Its IUPAC name is (3-fluorophenyl)-[4-(4-pyridin-3-yltriazol-1-yl)piperidin-1-yl]methanone.
| Compound Name | (3-fluorophenyl)-[4-(4-pyridin-3-yltriazol-1-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46984125 |
| Molecular Formula | C19H18FN5O |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (3-fluorophenyl)-[4-(4-pyridin-3-yltriazol-1-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCC(n2cc(-c3cccnc3)nn2)CC1 |
| InChI | InChI=1S/C19H18FN5O/c20-16-5-1-3-14(11-16)19(26)24-9-6-17(7-10-24)25-13-18(22-23-25)15-4-2-8-21-12-15/h1-5,8,11-13,17H,6-7,9-10H2 |
| InChIKey | GQGXIFFRXSWPPU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |