C19H27N5 — CID 46994455
3-[1-[1-(cyclohexylmethyl)piperidin-4-yl]triazol-4-yl]pyridine (PubChem CID 46994455) has the molecular formula C19H27N5 and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[1-[1-(cyclohexylmethyl)piperidin-4-yl]triazol-4-yl]pyridine.
| Compound Name | 3-[1-[1-(cyclohexylmethyl)piperidin-4-yl]triazol-4-yl]pyridine |
|---|---|
| PubChem CID | 46994455 |
| Molecular Formula | C19H27N5 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 3-[1-[1-(cyclohexylmethyl)piperidin-4-yl]triazol-4-yl]pyridine |
| SMILES | c1cncc(-c2cn(C3CCN(CC4CCCCC4)CC3)nn2)c1 |
| InChI | InChI=1S/C19H27N5/c1-2-5-16(6-3-1)14-23-11-8-18(9-12-23)24-15-19(21-22-24)17-7-4-10-20-13-17/h4,7,10,13,15-16,18H,1-3,5-6,8-9,11-12,14H2 |
| InChIKey | YHOBKUZQHSHTLV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |