C19H27N3 — CID 67453486
3-[2-tert-butyl-1-(cyclohexylmethyl)imidazol-4-yl]pyridine (PubChem CID 67453486) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-[2-tert-butyl-1-(cyclohexylmethyl)imidazol-4-yl]pyridine.
| Compound Name | 3-[2-tert-butyl-1-(cyclohexylmethyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 67453486 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 3-[2-tert-butyl-1-(cyclohexylmethyl)imidazol-4-yl]pyridine |
| SMILES | CC(C)(C)c1nc(-c2cccnc2)cn1CC1CCCCC1 |
| InChI | InChI=1S/C19H27N3/c1-19(2,3)18-21-17(16-10-7-11-20-12-16)14-22(18)13-15-8-5-4-6-9-15/h7,10-12,14-15H,4-6,8-9,13H2,1-3H3 |
| InChIKey | SGBOFDIEEDFICT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |