C17H24N2OS — CID 67456732
2-tert-butyl-1-(oxan-4-ylmethyl)-4-thiophen-3-ylimidazole (PubChem CID 67456732) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-tert-butyl-1-(oxan-4-ylmethyl)-4-thiophen-3-ylimidazole.
| Compound Name | 2-tert-butyl-1-(oxan-4-ylmethyl)-4-thiophen-3-ylimidazole |
|---|---|
| PubChem CID | 67456732 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-tert-butyl-1-(oxan-4-ylmethyl)-4-thiophen-3-ylimidazole |
| SMILES | CC(C)(C)c1nc(-c2ccsc2)cn1CC1CCOCC1 |
| InChI | InChI=1S/C17H24N2OS/c1-17(2,3)16-18-15(14-6-9-21-12-14)11-19(16)10-13-4-7-20-8-5-13/h6,9,11-13H,4-5,7-8,10H2,1-3H3 |
| InChIKey | WPZMTYWXWDTUAN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |