C18H24BrN3O — CID 87407652
2-bromo-6-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]pyridine (PubChem CID 87407652) has the molecular formula C18H24BrN3O and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-bromo-6-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]pyridine.
| Compound Name | 2-bromo-6-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]pyridine |
|---|---|
| PubChem CID | 87407652 |
| Molecular Formula | C18H24BrN3O |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-bromo-6-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]pyridine |
| SMILES | CC(C)(C)c1nc(-c2cccc(Br)n2)cn1CC1CCOCC1 |
| InChI | InChI=1S/C18H24BrN3O/c1-18(2,3)17-21-15(14-5-4-6-16(19)20-14)12-22(17)11-13-7-9-23-10-8-13/h4-6,12-13H,7-11H2,1-3H3 |
| InChIKey | FSWKNLAGVMRADO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|