C24H35N3O — CID 67457722
1-[3-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]phenyl]piperidine (PubChem CID 67457722) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is 1-[3-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]phenyl]piperidine.
| Compound Name | 1-[3-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 67457722 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | 1-[3-[2-tert-butyl-1-(oxan-4-ylmethyl)imidazol-4-yl]phenyl]piperidine |
| SMILES | CC(C)(C)c1nc(-c2cccc(N3CCCCC3)c2)cn1CC1CCOCC1 |
| InChI | InChI=1S/C24H35N3O/c1-24(2,3)23-25-22(18-27(23)17-19-10-14-28-15-11-19)20-8-7-9-21(16-20)26-12-5-4-6-13-26/h7-9,16,18-19H,4-6,10-15,17H2,1-3H3 |
| InChIKey | AORIWOYCQITFOB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |