C21H24N2O3 — CID 46984590
N-[2-(2-phenoxyethoxy)phenyl]-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide (PubChem CID 46984590) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(2-phenoxyethoxy)phenyl]-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide.
| Compound Name | N-[2-(2-phenoxyethoxy)phenyl]-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 46984590 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[2-(2-phenoxyethoxy)phenyl]-2-(1,2,3,6-tetrahydropyridin-4-yl)acetamide |
| SMILES | O=C(CC1=CCNCC1)Nc1ccccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C21H24N2O3/c24-21(16-17-10-12-22-13-11-17)23-19-8-4-5-9-20(19)26-15-14-25-18-6-2-1-3-7-18/h1-10,22H,11-16H2,(H,23,24) |
| InChIKey | CUTUIHPPPRBCJM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|