C16H20N2O2 — CID 46984652
N-(2-methoxyethyl)-N,2,7-trimethylquinoline-4-carboxamide (PubChem CID 46984652) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N,2,7-trimethylquinoline-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N,2,7-trimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46984652 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | N-(2-methoxyethyl)-N,2,7-trimethylquinoline-4-carboxamide |
| SMILES | COCCN(C)C(=O)c1cc(C)nc2cc(C)ccc12 |
| InChI | InChI=1S/C16H20N2O2/c1-11-5-6-13-14(10-12(2)17-15(13)9-11)16(19)18(3)7-8-20-4/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | AQSOXHRRHFCLDR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |