C18H23NO4S — CID 46984935
2-methoxy-5-[[2-methoxyethyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]benzoic acid (PubChem CID 46984935) has the molecular formula C18H23NO4S and a molecular weight of 349.45 g/mol. Its IUPAC name is 2-methoxy-5-[[2-methoxyethyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]benzoic acid.
| Compound Name | 2-methoxy-5-[[2-methoxyethyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 46984935 |
| Molecular Formula | C18H23NO4S |
| Molecular Weight | 349.45 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-methoxy-5-[[2-methoxyethyl-[(3-methylthiophen-2-yl)methyl]amino]methyl]benzoic acid |
| SMILES | COCCN(Cc1ccc(OC)c(C(=O)O)c1)Cc1sccc1C |
| InChI | InChI=1S/C18H23NO4S/c1-13-6-9-24-17(13)12-19(7-8-22-2)11-14-4-5-16(23-3)15(10-14)18(20)21/h4-6,9-10H,7-8,11-12H2,1-3H3,(H,20,21) |
| InChIKey | UJNDIHJMPYRBRR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |