C17H21F4NO3 — CID 46985229
N-cyclopropyl-N-[(3-ethoxyphenyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide (PubChem CID 46985229) has the molecular formula C17H21F4NO3 and a molecular weight of 363.35 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3-ethoxyphenyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide.
| Compound Name | N-cyclopropyl-N-[(3-ethoxyphenyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
|---|---|
| PubChem CID | 46985229 |
| Molecular Formula | C17H21F4NO3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-cyclopropyl-N-[(3-ethoxyphenyl)methyl]-2-(2,2,3,3-tetrafluoropropoxy)acetamide |
| SMILES | CCOc1cccc(CN(C(=O)COCC(F)(F)C(F)F)C2CC2)c1 |
| InChI | InChI=1S/C17H21F4NO3/c1-2-25-14-5-3-4-12(8-14)9-22(13-6-7-13)15(23)10-24-11-17(20,21)16(18)19/h3-5,8,13,16H,2,6-7,9-11H2,1H3 |
| InChIKey | DESFMUGWUQOYLK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|