C15H19N5OS — CID 46988006
1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]-3-piperidin-4-ylurea (PubChem CID 46988006) has the molecular formula C15H19N5OS and a molecular weight of 317.42 g/mol. Its IUPAC name is 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]-3-piperidin-4-ylurea.
| Compound Name | 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]-3-piperidin-4-ylurea |
|---|---|
| PubChem CID | 46988006 |
| Molecular Formula | C15H19N5OS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]-3-piperidin-4-ylurea |
| SMILES | Cc1ccc(-c2nnc(NC(=O)NC3CCNCC3)s2)cc1 |
| InChI | InChI=1S/C15H19N5OS/c1-10-2-4-11(5-3-10)13-19-20-15(22-13)18-14(21)17-12-6-8-16-9-7-12/h2-5,12,16H,6-9H2,1H3,(H2,17,18,20,21) |
| InChIKey | OIXATKSGOKJQLF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |