C19H32N4 — CID 46988247
1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)methanamine (PubChem CID 46988247) has the molecular formula C19H32N4 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)methanamine.
| Compound Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 46988247 |
| Molecular Formula | C19H32N4 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 1-[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]-N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)methanamine |
| SMILES | C1CCc2[nH]nc(CNC[C@@H]3CCCN4CCCC[C@H]34)c2CC1 |
| InChI | InChI=1S/C19H32N4/c1-2-8-16-17(9-3-1)21-22-18(16)14-20-13-15-7-6-12-23-11-5-4-10-19(15)23/h15,19-20H,1-14H2,(H,21,22)/t15-,19+/m0/s1 |
| InChIKey | NCCYGTVQIOQDJE-HNAYVOBHSA-N |
| XLogP | 3.03 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |