C18H23N3 — CID 131922629
N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 131922629) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 131922629 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-(1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazol-3-ylmethyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | c1ccc2c(c1)CC(NCc1n[nH]c3c1CCCCC3)C2 |
| InChI | InChI=1S/C18H23N3/c1-2-8-16-17(9-3-1)20-21-18(16)12-19-15-10-13-6-4-5-7-14(13)11-15/h4-7,15,19H,1-3,8-12H2,(H,20,21) |
| InChIKey | QKVDPHNUKASSIA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |