C16H18N4O3S — CID 77080680
1,1-dioxo-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 77080680) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is 1,1-dioxo-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 1,1-dioxo-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 77080680 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 1,1-dioxo-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)-3,4-dihydro-2H-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | O=C(NCc1n[nH]c2c1CCC2)C1Cc2ccccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C16H18N4O3S/c21-16(17-9-14-11-5-3-6-12(11)18-19-14)13-8-10-4-1-2-7-15(10)24(22,23)20-13/h1-2,4,7,13,20H,3,5-6,8-9H2,(H,17,21)(H,18,19) |
| InChIKey | JPVBBLQRYKBYIK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |