C18H27N3O2S — CID 46988821
(4S,6R)-N-[3-(2-ethylphenoxy)propyl]-N,6-dimethyl-2-sulfanylidene-1,3-diazinane-4-carboxamide (PubChem CID 46988821) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (4S,6R)-N-[3-(2-ethylphenoxy)propyl]-N,6-dimethyl-2-sulfanylidene-1,3-diazinane-4-carboxamide.
| Compound Name | (4S,6R)-N-[3-(2-ethylphenoxy)propyl]-N,6-dimethyl-2-sulfanylidene-1,3-diazinane-4-carboxamide |
|---|---|
| PubChem CID | 46988821 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (4S,6R)-N-[3-(2-ethylphenoxy)propyl]-N,6-dimethyl-2-sulfanylidene-1,3-diazinane-4-carboxamide |
| SMILES | CCc1ccccc1OCCCN(C)C(=O)[C@@H]1C[C@@H](C)NC(=S)N1 |
| InChI | InChI=1S/C18H27N3O2S/c1-4-14-8-5-6-9-16(14)23-11-7-10-21(3)17(22)15-12-13(2)19-18(24)20-15/h5-6,8-9,13,15H,4,7,10-12H2,1-3H3,(H2,19,20,24)/t13-,15+/m1/s1 |
| InChIKey | QMSNXBYWIYAQLN-HIFRSBDPSA-N |
| XLogP | 2.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|