C15H22N4O2 — CID 46990246
methyl (3aS,6aS)-5-(5-ethyl-2-methylpyrimidin-4-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 46990246) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is methyl (3aS,6aS)-5-(5-ethyl-2-methylpyrimidin-4-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-5-(5-ethyl-2-methylpyrimidin-4-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 46990246 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | methyl (3aS,6aS)-5-(5-ethyl-2-methylpyrimidin-4-yl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | CCc1cnc(C)nc1N1C[C@@H]2CNC[C@]2(C(=O)OC)C1 |
| InChI | InChI=1S/C15H22N4O2/c1-4-11-5-17-10(2)18-13(11)19-7-12-6-16-8-15(12,9-19)14(20)21-3/h5,12,16H,4,6-9H2,1-3H3/t12-,15-/m0/s1 |
| InChIKey | OXAIAZCYSLKUKI-WFASDCNBSA-N |
| XLogP | 0.55 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |