C20H26FN3 — CID 46990673
N'-[1-[4-(3-fluorophenyl)phenyl]piperidin-4-yl]propane-1,3-diamine (PubChem CID 46990673) has the molecular formula C20H26FN3 and a molecular weight of 327.45 g/mol. Its IUPAC name is N'-[1-[4-(3-fluorophenyl)phenyl]piperidin-4-yl]propane-1,3-diamine.
| Compound Name | N'-[1-[4-(3-fluorophenyl)phenyl]piperidin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 46990673 |
| Molecular Formula | C20H26FN3 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | N'-[1-[4-(3-fluorophenyl)phenyl]piperidin-4-yl]propane-1,3-diamine |
| SMILES | NCCCNC1CCN(c2ccc(-c3cccc(F)c3)cc2)CC1 |
| InChI | InChI=1S/C20H26FN3/c21-18-4-1-3-17(15-18)16-5-7-20(8-6-16)24-13-9-19(10-14-24)23-12-2-11-22/h1,3-8,15,19,23H,2,9-14,22H2 |
| InChIKey | QLBFMPFWXLZSER-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|