C17H29N5O — CID 46991450
[4-[4-(2-aminopropan-2-yl)triazol-1-yl]piperidin-1-yl]-cyclohexylmethanone (PubChem CID 46991450) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is [4-[4-(2-aminopropan-2-yl)triazol-1-yl]piperidin-1-yl]-cyclohexylmethanone.
| Compound Name | [4-[4-(2-aminopropan-2-yl)triazol-1-yl]piperidin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 46991450 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | [4-[4-(2-aminopropan-2-yl)triazol-1-yl]piperidin-1-yl]-cyclohexylmethanone |
| SMILES | CC(C)(N)c1cn(C2CCN(C(=O)C3CCCCC3)CC2)nn1 |
| InChI | InChI=1S/C17H29N5O/c1-17(2,18)15-12-22(20-19-15)14-8-10-21(11-9-14)16(23)13-6-4-3-5-7-13/h12-14H,3-11,18H2,1-2H3 |
| InChIKey | MFBVNSZACIZWAG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |