C17H32N6 — CID 46990920
2-[1-[1-(1-ethylpiperidin-4-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine (PubChem CID 46990920) has the molecular formula C17H32N6 and a molecular weight of 320.49 g/mol. Its IUPAC name is 2-[1-[1-(1-ethylpiperidin-4-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine.
| Compound Name | 2-[1-[1-(1-ethylpiperidin-4-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine |
|---|---|
| PubChem CID | 46990920 |
| Molecular Formula | C17H32N6 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-[1-[1-(1-ethylpiperidin-4-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine |
| SMILES | CCN1CCC(N2CCC(n3cc(C(C)(C)N)nn3)CC2)CC1 |
| InChI | InChI=1S/C17H32N6/c1-4-21-9-5-14(6-10-21)22-11-7-15(8-12-22)23-13-16(19-20-23)17(2,3)18/h13-15H,4-12,18H2,1-3H3 |
| InChIKey | HEIGAXMCMBNKEB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |