C25H33F6N5O5 — CID 154887908
2-[1-[1-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 154887908) has the molecular formula C25H33F6N5O5 and a molecular weight of 597.56 g/mol. Its IUPAC name is 2-[1-[1-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[1-[1-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 154887908 |
| Molecular Formula | C25H33F6N5O5 |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 2-[1-[1-(7-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)piperidin-4-yl]triazol-4-yl]propan-2-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1ccc2c(c1)CC(N1CCC(n3cc(C(C)(C)N)nn3)CC1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H31N5O.2C2HF3O2/c1-21(2,22)20-14-26(24-23-20)17-8-10-25(11-9-17)18-6-4-15-5-7-19(27-3)13-16(15)12-18;2*3-2(4,5)1(6)7/h5,7,13-14,17-18H,4,6,8-12,22H2,1-3H3;2*(H,6,7) |
| InChIKey | NZWWXTOVXZTDNV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |