C17H28N2O5 — CID 46994260
ethyl 2-[4-[4-(cyclopentylamino)-4-oxobutanoyl]morpholin-3-yl]acetate (PubChem CID 46994260) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is ethyl 2-[4-[4-(cyclopentylamino)-4-oxobutanoyl]morpholin-3-yl]acetate.
| Compound Name | ethyl 2-[4-[4-(cyclopentylamino)-4-oxobutanoyl]morpholin-3-yl]acetate |
|---|---|
| PubChem CID | 46994260 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | ethyl 2-[4-[4-(cyclopentylamino)-4-oxobutanoyl]morpholin-3-yl]acetate |
| SMILES | CCOC(=O)CC1COCCN1C(=O)CCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H28N2O5/c1-2-24-17(22)11-14-12-23-10-9-19(14)16(21)8-7-15(20)18-13-5-3-4-6-13/h13-14H,2-12H2,1H3,(H,18,20) |
| InChIKey | HWHRDVLJEQMNPZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |