C19H30N4O4 — CID 25369911
ethyl 2-[(3R)-4-[1-(2-cyclohexylethyl)triazole-4-carbonyl]morpholin-3-yl]acetate (PubChem CID 25369911) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl 2-[(3R)-4-[1-(2-cyclohexylethyl)triazole-4-carbonyl]morpholin-3-yl]acetate.
| Compound Name | ethyl 2-[(3R)-4-[1-(2-cyclohexylethyl)triazole-4-carbonyl]morpholin-3-yl]acetate |
|---|---|
| PubChem CID | 25369911 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | ethyl 2-[(3R)-4-[1-(2-cyclohexylethyl)triazole-4-carbonyl]morpholin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1COCCN1C(=O)c1cn(CCC2CCCCC2)nn1 |
| InChI | InChI=1S/C19H30N4O4/c1-2-27-18(24)12-16-14-26-11-10-23(16)19(25)17-13-22(21-20-17)9-8-15-6-4-3-5-7-15/h13,15-16H,2-12,14H2,1H3/t16-/m1/s1 |
| InChIKey | INOMNQYETLKOEK-MRXNPFEDSA-N |
| XLogP | 2.04 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |