C16H18N4O4 — CID 129469806
2-[(3S)-4-[1-(3-methylphenyl)triazole-4-carbonyl]morpholin-3-yl]acetic acid (PubChem CID 129469806) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-[(3S)-4-[1-(3-methylphenyl)triazole-4-carbonyl]morpholin-3-yl]acetic acid.
| Compound Name | 2-[(3S)-4-[1-(3-methylphenyl)triazole-4-carbonyl]morpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 129469806 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[(3S)-4-[1-(3-methylphenyl)triazole-4-carbonyl]morpholin-3-yl]acetic acid |
| SMILES | Cc1cccc(-n2cc(C(=O)N3CCOC[C@@H]3CC(=O)O)nn2)c1 |
| InChI | InChI=1S/C16H18N4O4/c1-11-3-2-4-12(7-11)20-9-14(17-18-20)16(23)19-5-6-24-10-13(19)8-15(21)22/h2-4,7,9,13H,5-6,8,10H2,1H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | IDTMXJOPPGSVQC-ZDUSSCGKSA-N |
| XLogP | 0.89 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |