C24H26N4O4 — CID 45178950
ethyl 2-[4-(1-benzhydryltriazole-4-carbonyl)morpholin-3-yl]acetate (PubChem CID 45178950) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is ethyl 2-[4-(1-benzhydryltriazole-4-carbonyl)morpholin-3-yl]acetate.
| Compound Name | ethyl 2-[4-(1-benzhydryltriazole-4-carbonyl)morpholin-3-yl]acetate |
|---|---|
| PubChem CID | 45178950 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | ethyl 2-[4-(1-benzhydryltriazole-4-carbonyl)morpholin-3-yl]acetate |
| SMILES | CCOC(=O)CC1COCCN1C(=O)c1cn(C(c2ccccc2)c2ccccc2)nn1 |
| InChI | InChI=1S/C24H26N4O4/c1-2-32-22(29)15-20-17-31-14-13-27(20)24(30)21-16-28(26-25-21)23(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,16,20,23H,2,13-15,17H2,1H3 |
| InChIKey | WBQAXPIRNJUNHU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |