C17H28N4O2 — CID 46994542
1-[4-(4-butyltriazol-1-yl)piperidin-1-yl]-4-methylpentane-1,2-dione (PubChem CID 46994542) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-[4-(4-butyltriazol-1-yl)piperidin-1-yl]-4-methylpentane-1,2-dione.
| Compound Name | 1-[4-(4-butyltriazol-1-yl)piperidin-1-yl]-4-methylpentane-1,2-dione |
|---|---|
| PubChem CID | 46994542 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 1-[4-(4-butyltriazol-1-yl)piperidin-1-yl]-4-methylpentane-1,2-dione |
| SMILES | CCCCc1cn(C2CCN(C(=O)C(=O)CC(C)C)CC2)nn1 |
| InChI | InChI=1S/C17H28N4O2/c1-4-5-6-14-12-21(19-18-14)15-7-9-20(10-8-15)17(23)16(22)11-13(2)3/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | VFIKRWXHUQBZOP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|