C12H21N3O — CID 101445678
trans-(1R,2R)-2-(4-butyltriazol-1-yl)cyclohexan-1-ol (PubChem CID 101445678) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-butyltriazol-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(4-butyltriazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 101445678 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | trans-(1R,2R)-2-(4-butyltriazol-1-yl)cyclohexan-1-ol |
| SMILES | CCCCc1cn([C@@H]2CCCC[C@H]2O)nn1 |
| InChI | InChI=1S/C12H21N3O/c1-2-3-6-10-9-15(14-13-10)11-7-4-5-8-12(11)16/h9,11-12,16H,2-8H2,1H3/t11-,12-/m1/s1 |
| InChIKey | PZTUVVPYMMFSAE-VXGBXAGGSA-N |
| XLogP | 2.10 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |