C14H25N3O3 — CID 24763252
trans-(1R,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol (PubChem CID 24763252) has the molecular formula C14H25N3O3 and a molecular weight of 283.37 g/mol. Its IUPAC name is trans-(1R,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 24763252 |
| Molecular Formula | C14H25N3O3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | trans-(1R,2R)-4,4-bis(hydroxymethyl)-2-(4-pentyltriazol-1-yl)cyclopentan-1-ol |
| SMILES | CCCCCc1cn([C@@H]2CC(CO)(CO)C[C@H]2O)nn1 |
| InChI | InChI=1S/C14H25N3O3/c1-2-3-4-5-11-8-17(16-15-11)12-6-14(9-18,10-19)7-13(12)20/h8,12-13,18-20H,2-7,9-10H2,1H3/t12-,13-/m1/s1 |
| InChIKey | XJYRKSZWOHNLFU-CHWSQXEVSA-N |
| XLogP | 0.68 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|