C32H33IN2O5 — CID 4699503
4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-iodophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 4699503) has the molecular formula C32H33IN2O5 and a molecular weight of 652.53 g/mol. Its IUPAC name is 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-iodophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-iodophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4699503 |
| Molecular Formula | C32H33IN2O5 |
| Molecular Weight | 652.53 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | 4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-iodophenyl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccccc1COc1ccc(C(O)=C2C(=O)C(=O)N(CCCN3CCOCC3)C2c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C32H33IN2O5/c1-22-5-2-3-6-25(22)21-40-27-13-9-24(10-14-27)30(36)28-29(23-7-11-26(33)12-8-23)35(32(38)31(28)37)16-4-15-34-17-19-39-20-18-34/h2-3,5-14,29,36H,4,15-21H2,1H3 |
| InChIKey | KBQJDCHOMNDLSY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|