C33H35BrN2O7 — CID 4699372
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 4699372) has the molecular formula C33H35BrN2O7 and a molecular weight of 651.55 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4699372 |
| Molecular Formula | C33H35BrN2O7 |
| Molecular Weight | 651.55 g/mol |
| Exact Mass | 650.16 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCCN2CCOCC2)cc(Br)c1O |
| InChI | InChI=1S/C33H35BrN2O7/c1-21-6-3-4-7-23(21)20-43-25-10-8-22(9-11-25)30(37)28-29(24-18-26(34)31(38)27(19-24)41-2)36(33(40)32(28)39)13-5-12-35-14-16-42-17-15-35/h3-4,6-11,18-19,29,37-38H,5,12-17,20H2,1-2H3 |
| InChIKey | VUWDOZUIVVSLLU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|