C31H33BrN2O6 — CID 6191915
(4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione (PubChem CID 6191915) has the molecular formula C31H33BrN2O6 and a molecular weight of 609.52 g/mol. Its IUPAC name is (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6191915 |
| Molecular Formula | C31H33BrN2O6 |
| Molecular Weight | 609.52 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | (4E)-5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-[3-(dimethylamino)propyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCCN(C)C)cc(Br)c1O |
| InChI | InChI=1S/C31H33BrN2O6/c1-19-8-5-6-9-21(19)18-40-23-12-10-20(11-13-23)28(35)26-27(22-16-24(32)29(36)25(17-22)39-4)34(31(38)30(26)37)15-7-14-33(2)3/h5-6,8-13,16-17,27,35-36H,7,14-15,18H2,1-4H3/b28-26+ |
| InChIKey | ODFHHMLOGOEXKF-BYCLXTJYSA-N |
| XLogP | 5.42 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|